2-(4-methoxy-phenyl)-quinoline-4-carboxylic acid structure
|
Common Name | 2-(4-methoxy-phenyl)-quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4364-02-7 | Molecular Weight | 279.29000 | |
| Density | 1.277g/cm3 | Boiling Point | 486.4ºC at 760mmHg | |
| Molecular Formula | C17H13NO3 | Melting Point | 210ºC | |
| MSDS | N/A | Flash Point | 248ºC | |
| Name | 2-(4-Methoxyphenyl)-4-quinolinecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 486.4ºC at 760mmHg |
| Melting Point | 210ºC |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.29000 |
| Flash Point | 248ºC |
| Exact Mass | 279.09000 |
| PSA | 59.42000 |
| LogP | 3.60860 |
| InChIKey | ZCNPYYVKVXSLQF-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(C(=O)O)c3ccccc3n2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933499090 |
|
~91%
2-(4-methoxy-ph... CAS#:4364-02-7 |
| Literature: NEUROSEARCH A/S Patent: US2011/207773 A1, 2011 ; Location in patent: Page/Page column 7 ; |
|
~%
2-(4-methoxy-ph... CAS#:4364-02-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 11, # 4 p. 541 - 544 |
|
~75%
2-(4-methoxy-ph... CAS#:4364-02-7 |
| Literature: Wang, Li-Min; Hu, Liang; Chen, Hong-Juan; Sui, Yuan-Yuan; Shen, Wei Journal of Fluorine Chemistry, 2009 , vol. 130, # 4 p. 406 - 409 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00160581 |
| 2-(4-methoxyphenyl)quinoline-4-carboxylic acid |