Benzenebutanoic acid, g-oxo-a-phenyl- structure
|
Common Name | Benzenebutanoic acid, g-oxo-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 4370-96-1 | Molecular Weight | 254.28100 | |
| Density | 1.21g/cm3 | Boiling Point | 453.7ºC at 760mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.3ºC | |
| Name | 4-oxo-2,4-diphenylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 453.7ºC at 760mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 242.3ºC |
| Exact Mass | 254.09400 |
| PSA | 54.37000 |
| LogP | 3.12780 |
| Index of Refraction | 1.597 |
| InChIKey | BTJVYXJKBFVHPY-UHFFFAOYSA-N |
| SMILES | O=C(CC(C(=O)O)c1ccccc1)c1ccccc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ghl.PD_Mitscher_leg0.1057 |