Benzenebutanoic acid, g-oxo-4-(phenylmethyl)- structure
|
Common Name | Benzenebutanoic acid, g-oxo-4-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 63471-85-2 | Molecular Weight | 268.30700 | |
| Density | 1.176g/cm3 | Boiling Point | 482.6ºC at 760mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.7ºC | |
| Name | 4-(4-benzylphenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 482.6ºC at 760mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 259.7ºC |
| Exact Mass | 268.11000 |
| PSA | 54.37000 |
| LogP | 3.32490 |
| Index of Refraction | 1.585 |
| InChIKey | MGWNKUFPLYQEQS-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc(Cc2ccccc2)cc1 |
| HS Code | 2918300090 |
|---|
|
~67%
Benzenebutanoic... CAS#:63471-85-2 |
| Literature: Khan; Siddiqui Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2000 , vol. 39, # 8 p. 614 - 619 |
|
~%
Detail
|
| Literature: Cook; Robinson; Roe Journal of the Chemical Society, 1939 , p. 266 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(4-benzyl-phenyl)-4-oxo-butyric acid |
| 4-(4-Benzyl-phenyl)-4-oxo-buttersaeure |
| 4-(diphenylmethylene)-4-oxobutanoic acid |
| 4-oxo-4-[4-benzylphenyl]butanoic acid |
| 3-(4-Benzylphenylcarbonyl)propionsaeure |