2-methyl-2-phenethyl-propanedioic acid
Modify Date: 2025-08-26 17:49:29
2-methyl-2-phenethyl-propanedioic acid structure
|
Common Name | 2-methyl-2-phenethyl-propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 4371-01-1 | Molecular Weight | 222.23700 | |
| Density | 1.251g/cm3 | Boiling Point | 395.5ºC at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.2ºC | |
| Name | 2-methyl-2-(2-phenylethyl)propanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 395.5ºC at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 207.2ºC |
| Exact Mass | 222.08900 |
| PSA | 74.60000 |
| LogP | 1.79470 |
| Index of Refraction | 1.56 |
| InChIKey | OLXGONJGVSASEW-UHFFFAOYSA-N |
| SMILES | CC(CCc1ccccc1)(C(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
|
~%
2-methyl-2-phen... CAS#:4371-01-1 |
| Literature: v. Braun; Kruber Chemische Berichte, 1912 , vol. 45, p. 396 |
|
~%
2-methyl-2-phen... CAS#:4371-01-1 |
| Literature: Buchta,E.; Meyer,K. Chemische Berichte, 1962 , vol. 95, p. 213 - 221 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1949-41-3| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Methyl-phenaethyl-malonsaeure |
| 2-methyl-2-phenethylpropanedioic acid |
| methyl-phenethyl-malonic acid |