Propanedioic acid,ethyl(1-methylpropyl)
Modify Date: 2025-11-30 19:30:29
Propanedioic acid,ethyl(1-methylpropyl) structure
|
Common Name | Propanedioic acid,ethyl(1-methylpropyl) | ||
|---|---|---|---|---|
| CAS Number | 4372-17-2 | Molecular Weight | 188.22100 | |
| Density | 1.128g/cm3 | Boiling Point | 338.2ºC at 760 mmHg | |
| Molecular Formula | C9H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.5ºC | |
| Name | 2-butan-2-yl-2-ethylpropanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 338.2ºC at 760 mmHg |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22100 |
| Flash Point | 172.5ºC |
| Exact Mass | 188.10500 |
| PSA | 74.60000 |
| LogP | 1.59810 |
| Index of Refraction | 1.473 |
| InChIKey | GFYCUEYACNCMPX-UHFFFAOYSA-N |
| SMILES | CCC(C)C(CC)(C(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
|
~%
Propanedioic ac... CAS#:4372-17-2 |
| Literature: Katznelsson; Kondakowa Doklad Akad. S.S.S.R., 1934 , p. II 24 Chem. Zentralbl., 1935 , vol. 106, # I p. 2521 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:4171-13-5
CAS#:22414-77-3| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
Total 1, Current Page 1 of 1
1
| 2-Sec-butyl-2-ethylmalonic acid |
| ethyl 2-(2-butyl)malonic acid |
| butan-2-yl(ethyl)propanedioic acid |
| Aethyl-sec-butyl-malonsaeure |
| ethyl-sec-butyl-malonic acid |