Diethyl ethyl(1-methylpropyl)malonate
Diethyl ethyl(1-methylpropyl)malonate structure
|
Common Name | Diethyl ethyl(1-methylpropyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 76-71-1 | Molecular Weight | 244.32700 | |
| Density | 0.975 g/cm3 | Boiling Point | 253ºC at 760 mmHg | |
| Molecular Formula | C13H24O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 107.5ºC | |
Summary: Diethyl ethyl(1-methylpropyl)malonate, Chinese name 乙基(1-甲基丙基)丙二酸二乙酯, CAS number 76-71-1, molecular formula C13H24O4, molecular weight 244.32700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diethyl ethyl(1-methylpropyl)malonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.975 g/cm3 |
|---|---|
| Boiling Point | 253ºC at 760 mmHg |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.32700 |
| Flash Point | 107.5ºC |
| Exact Mass | 244.16700 |
| PSA | 52.60000 |
| LogP | 2.55510 |
| Index of Refraction | 1.437 |
| InChIKey | WZFGIKMWBJCRBU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)(C(=O)OCC)C(C)CC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 2 | |
CAS#:78-76-2
CAS#:83-27-2
CAS#:141-52-6
CAS#:125-40-6
CAS#:4372-17-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| DIETHYL ETHYL(SEC-BUTYL)MALONATE |
| Aethyl-sec-butyl-malonsaeure-diaethylester |
| ethyl-sec-butyl-malonic acid diethyl ester |
| DIETYHL ETHYL(1-METHYLPROPYL)MALONATE |
| diethyl 2-butan-2-yl-2-ethyl-propanedioate |
| EINECS 200-980-1 |
| Ethyl(1-methylpropyl)propanedioic acid diethyl ester |
| DIETHYL (2-BUTYL)ETHYLMALONATE |
| DIETHYL2-SEC-BUTYL-2-ETHYLMALONATE |
| Ethyl-ethyl-sec-butylmalonat |
| 2-ethyl-2-sec-butyl-malonic acid diethyl ester |
| 2-SEC-BUTYL-2-ETHYLMALONIC ACID DIETHYL ESTER |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Diethyl ethyl(1-methylpropyl)malonate? |
| A: Molecular formula of Diethyl ethyl(1-methylpropyl)malonate is C13H24O4. |
| Q: What is the SMILES notation of Diethyl ethyl(1-methylpropyl)malonate? |
| A: SMILES notation of Diethyl ethyl(1-methylpropyl)malonate is CCOC(=O)C(CC)(C(=O)OCC)C(C)CC. |
| Q: What is the English name of Diethyl ethyl(1-methylpropyl)malonate? |
| A: The English name of Diethyl ethyl(1-methylpropyl)malonate is Diethyl ethyl(1-methylpropyl)malonate. |
| Q: What are the upstream materials of Diethyl ethyl(1-methylpropyl)malonate? |
| A: Related upstream materials(CAS) of Diethyl ethyl(1-methylpropyl)malonate: 78-76-2;83-27-2;141-52-6. |
| Q: What is the LogP of Diethyl ethyl(1-methylpropyl)malonate? |
| A: LogP of Diethyl ethyl(1-methylpropyl)malonate is 2.55510. |
| Q: What is the molecular weight of Diethyl ethyl(1-methylpropyl)malonate? |
| A: Molecular weight of Diethyl ethyl(1-methylpropyl)malonate is 244.32700. |
| Q: What is the InChIKey of Diethyl ethyl(1-methylpropyl)malonate? |
| A: InChIKey of Diethyl ethyl(1-methylpropyl)malonate is WZFGIKMWBJCRBU-UHFFFAOYSA-N. |
| Q: What are the downstream products of Diethyl ethyl(1-methylpropyl)malonate? |
| A: Related downstream products(CAS) of Diethyl ethyl(1-methylpropyl)malonate: 125-40-6;4372-17-2. |
| Q: What is the polar surface area (PSA) of Diethyl ethyl(1-methylpropyl)malonate? |
| A: Polar surface area (PSA) of Diethyl ethyl(1-methylpropyl)malonate is 52.60000. |
| Q: What is the CAS number of Diethyl ethyl(1-methylpropyl)malonate? |
| A: CAS number of Diethyl ethyl(1-methylpropyl)malonate is 76-71-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |