2,2,5,5-tetramethylhexane-3,4-dione structure
|
Common Name | 2,2,5,5-tetramethylhexane-3,4-dione | ||
|---|---|---|---|---|
| CAS Number | 4388-88-9 | Molecular Weight | 170.24900 | |
| Density | 0.905g/cm3 | Boiling Point | 194.2ºC at 760 mmHg | |
| Molecular Formula | C10H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 67ºC | |
| Name | 2,2,5,5-tetramethylhexane-3,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 0.905g/cm3 |
|---|---|
| Boiling Point | 194.2ºC at 760 mmHg |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.24900 |
| Flash Point | 67ºC |
| Exact Mass | 170.13100 |
| PSA | 34.14000 |
| LogP | 2.21680 |
| Index of Refraction | 1.428 |
| InChIKey | HYUPEESAUWXGDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(=O)C(C)(C)C |
| HS Code | 2914190090 |
|---|
| HS Code | 2914190090 |
|---|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2,2,5,5-Tetramethylhexan-3,4-dion |
| 3,2,2,5,5-tetramethyl |
| 2,2,5,5-tetramethyl-3,4-hexandione |
| Pivalil |
| 2,2,5,5-tetramethyl-3,4-hexanedione |
| 3,4-Hexanedione,2,2,5,5-tetramethyl |
| 2,5,5-Tetramethyl-3,4-hexanedione |