3-Hexanone,4-hydroxy-2,2,5,5-tetramethyl- structure
|
Common Name | 3-Hexanone,4-hydroxy-2,2,5,5-tetramethyl- | ||
|---|---|---|---|---|
| CAS Number | 815-66-7 | Molecular Weight | 172.26500 | |
| Density | 0.912g/cm3 | Boiling Point | 198.9ºC at 760 mmHg | |
| Molecular Formula | C10H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 77.7ºC | |
| Name | 4-hydroxy-2,2,5,5-tetramethylhexan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.912g/cm3 |
|---|---|
| Boiling Point | 198.9ºC at 760 mmHg |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.26500 |
| Flash Point | 77.7ºC |
| Exact Mass | 172.14600 |
| PSA | 37.30000 |
| LogP | 2.00860 |
| Index of Refraction | 1.441 |
| InChIKey | YMRDPCUYKKPMFC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(O)C(C)(C)C |
| HS Code | 2914400090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Pivaloin |
| HMS1649P03 |
| 4-Hydroxy-2,2,5,5-tetramethyl-hexan-3-on |
| 4-hydroxy-2,2,5,5-tetramethyl-hexan-3-one |