Vapendavir structure
|
Common Name | Vapendavir | ||
|---|---|---|---|---|
| CAS Number | 439085-51-5 | Molecular Weight | 382.45600 | |
| Density | 1.191±0.06 g/cm3(Predicted) | Boiling Point | 612.0±55.0 °C(Predicted) | |
| Molecular Formula | C21H26N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VapendavirVapendavir (BTA798) is a potent enteroviral capsid binder (CB). Vapendavir (BTA798) possesses potent antiviral activity for enterovirus 71 (EV71) replication, with EC50 values of 0.5-1.4 μM in different EV71 strains[1][2]. |
| Name | 3-ethoxy-6-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-1,2-benzoxazole |
|---|---|
| Synonym | More Synonyms |
| Description | Vapendavir (BTA798) is a potent enteroviral capsid binder (CB). Vapendavir (BTA798) possesses potent antiviral activity for enterovirus 71 (EV71) replication, with EC50 values of 0.5-1.4 μM in different EV71 strains[1][2]. |
|---|---|
| Related Catalog | |
| Target |
EC50: 0.5-1.4 μM (EV71 strains)[1][2]. |
| References |
| Density | 1.191±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 612.0±55.0 °C(Predicted) |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.45600 |
| Exact Mass | 382.20000 |
| PSA | 73.51000 |
| LogP | 4.07540 |
| InChIKey | DKSVBVKHUICELN-UHFFFAOYSA-N |
| SMILES | CCOc1noc2cc(OCCC3CCN(c4ccc(C)nn4)CC3)ccc12 |
| 3-Ethoxy-6-{2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy}-1,2-benzisoxazole |
| Vapendavir [INN] |
| Vapendavir |
| UNII-Q8LVL5Z68H |
| 3-Ethoxy-6-(2-(1-(6-methylpyridazin-3-yl)piperidin-4-yl)ethoxy)-1,2-benzoxazole |