Syringetin structure
|
Common Name | Syringetin | ||
|---|---|---|---|---|
| CAS Number | 4423-37-4 | Molecular Weight | 346.29 | |
| Density | 1.591 g/cm3 | Boiling Point | 622.4ºC at 760mmHg | |
| Molecular Formula | C17H14O8 | Melting Point | 287-289ºC | |
| MSDS | N/A | Flash Point | 1.591ºC | |
Use of SyringetinSyringetin, a flavonoid derivative, is associated with increased BMP-2 production. Syringetin stimulates osteoblast differentiation at various stages, from maturation to terminally differentiated osteoblasts[1]. |
| Name | syringetin |
|---|---|
| Synonym | More Synonyms |
| Description | Syringetin, a flavonoid derivative, is associated with increased BMP-2 production. Syringetin stimulates osteoblast differentiation at various stages, from maturation to terminally differentiated osteoblasts[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.591 g/cm3 |
|---|---|
| Boiling Point | 622.4ºC at 760mmHg |
| Melting Point | 287-289ºC |
| Molecular Formula | C17H14O8 |
| Molecular Weight | 346.29 |
| Flash Point | 1.591ºC |
| Exact Mass | 346.06900 |
| PSA | 129.59000 |
| LogP | 2.29960 |
| Index of Refraction | 1.707 |
| InChIKey | UZMAPBJVXOGOFT-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc(OC)c1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3',5'-O-Dimethylmyricetin |
| 3',5'-Dimethoxy-3,5,7,4'-tetrahydroxyflavone |
| Syringetin |
| 3,5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one |