fructosylglycine structure
|
Common Name | fructosylglycine | ||
|---|---|---|---|---|
| CAS Number | 4429-05-4 | Molecular Weight | 237.207 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 638.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C8H15NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.1±31.5 °C | |
| Name | fructosylglycine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 638.8±55.0 °C at 760 mmHg |
| Molecular Formula | C8H15NO7 |
| Molecular Weight | 237.207 |
| Flash Point | 340.1±31.5 °C |
| Exact Mass | 237.084854 |
| PSA | 147.32000 |
| LogP | -1.06 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | YGUYJMQMTNJNFS-LPBLVHEISA-N |
| SMILES | O=C(O)CNCC(=O)C(O)C(O)C(O)CO |
| HS Code | 2924199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Fructosyl-glycine |
| D-Fructose, 1-[(carboxymethyl)amino]-1-deoxy- |
| 1-[(carboxymethyl)amino]-1-deoxy-D-fructose |
| 2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]acetic acid |
| N-(1-deoxy-D-fructos-1-yl)glycine |
| Glycine,N-(1-deoxy-D-fructos-1-yl) |
| {[(3S,4R,5R)-3,4,5,6-Tetrahydroxy-2-oxohexyl]amino}acetic acid |
| fructoseglycine |