(|S|)-(-)-2,2',6,6'-Tetramethoxy-4,4'-bis[di(3,5-xylyl)phosphino]-3,3'-bipyridine structure
|
Common Name | (|S|)-(-)-2,2',6,6'-Tetramethoxy-4,4'-bis[di(3,5-xylyl)phosphino]-3,3'-bipyridine | ||
|---|---|---|---|---|
| CAS Number | 443347-10-2 | Molecular Weight | 756.84800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C46H50N2O4P2 | Melting Point | 158-162ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (S)-()-2,2′,6,6′-Tetramethoxy-4,4′-bis[di(3,5-xylyl)phosphino]-3,3′-bipyridine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 158-162ºC |
|---|---|
| Molecular Formula | C46H50N2O4P2 |
| Molecular Weight | 756.84800 |
| Exact Mass | 756.32500 |
| PSA | 89.88000 |
| LogP | 8.16160 |
| InChIKey | PZONOJABJRHSFK-UHFFFAOYSA-N |
| SMILES | COc1cc(P(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c(-c2c(P(c3cc(C)cc(C)c3)c3cc(C)cc(C)c3)cc(OC)nc2OC)c(OC)n1.COc1cc(P(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c(-c2c(P(c3cc(C)cc(C)c3)c3cc(C)cc(C)c3)cc(OC)nc2OC)c(OC)n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
|
P-Phos: a family of versatile and effective atropisomeric dipyridylphosphine ligands in asymmetric catalysis.
Acc. Chem. Res. 39 , 711, (2006) This Account outlines our efforts in the design and synthesis of a family of highly effective atropisomeric dipyridylphosphine ligands (P-Phos and its variants) and in the development of their widespr... |
| MFCD04974235 |
| (S)-Xylyl-P-Phos |
| (S)-(-)-2,2',6,6'-Tetramethoxy-4,4'-bis[di(3,5-xylyl)phosphino]-3,3'-bipyridine |
| (R)-(+)-2,2',6,6'-TETRAMETHOXY-4,4'-BIS(DI(3,5-XYLYL)PHOSPHINO)-3,3'-BIPYRIDINE |