1H-Pyrrole-2,4-dicarboxylicacid, 5-bromo-3-methyl-, 2,4-diethyl ester structure
|
Common Name | 1H-Pyrrole-2,4-dicarboxylicacid, 5-bromo-3-methyl-, 2,4-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 4458-69-9 | Molecular Weight | 304.13700 | |
| Density | 1.455g/cm3 | Boiling Point | 405.5ºC at 760 mmHg | |
| Molecular Formula | C11H14BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.1ºC | |
| Name | diethyl 5-bromo-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 405.5ºC at 760 mmHg |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.13700 |
| Flash Point | 199.1ºC |
| Exact Mass | 303.01100 |
| PSA | 68.39000 |
| LogP | 2.43900 |
| Index of Refraction | 1.544 |
| InChIKey | HZOLBIKWGVUBGF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c(Br)c(C(=O)OCC)c1C |
|
~82%
1H-Pyrrole-2,4-... CAS#:4458-69-9 |
| Literature: Giuliano, Francesco; Penna, Marina; Sleiter, Giancarlo Gazzetta Chimica Italiana, 1986 , vol. 116, # 10 p. 589 - 594 |
|
~%
1H-Pyrrole-2,4-... CAS#:4458-69-9 |
| Literature: Corwin et al. Journal of the American Chemical Society, 1942 , vol. 64, p. 1267,1271 |
|
~%
1H-Pyrrole-2,4-... CAS#:4458-69-9 |
| Literature: Corwin et al. Journal of the American Chemical Society, 1942 , vol. 64, p. 1267,1271 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| diethyl 5-bromo-3-methylpyrrole-2,4-dicarboxylate |
| 5-Brom-3-methyl-pyrrol-2,4-dicarbonsaeure-diethylester |
| 5-Brom-3-methyl-pyrrol-2,4-dicarbonsaeure-diaethylester |
| 5-bromo-3-methyl-pyrrole-2,4-dicarboxylic acid diethyl ester |