2,4-dinitro-6-octylphenol structure
|
Common Name | 2,4-dinitro-6-octylphenol | ||
|---|---|---|---|---|
| CAS Number | 4467-92-9 | Molecular Weight | 296.31900 | |
| Density | 1.217g/cm3 | Boiling Point | 418.9ºC at 760mmHg | |
| Molecular Formula | C14H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.8ºC | |
| Name | 2,4-dinitro-6-octylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 418.9ºC at 760mmHg |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.31900 |
| Flash Point | 168.8ºC |
| Exact Mass | 296.13700 |
| PSA | 111.87000 |
| LogP | 5.15800 |
| Index of Refraction | 1.558 |
| InChIKey | XQJDAXOHZWCJFD-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
|
~%
2,4-dinitro-6-o... CAS#:4467-92-9 |
| Literature: Dutton et al. Canadian Journal of Chemistry, 1953 , vol. 31, p. 837,839 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3.5-dinitro-2-hydroxy-1-octyl-benzene |
| Phenol,2,4-dinitro-6-octyl |
| 3.5-Dinitro-2-hydroxy-1-octyl-benzol |
| 2-Octyl-4,6-dinitrophenol |