2,4-dinitro-6-(1-methylheptyl)phenol
Modify Date: 2025-09-28 11:45:03
2,4-dinitro-6-(1-methylheptyl)phenol structure
|
Common Name | 2,4-dinitro-6-(1-methylheptyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 3687-22-7 | Molecular Weight | 296.31900 | |
| Density | 1.213g/cm3 | Boiling Point | 377.4ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.3ºC | |
| Name | 2,4-dinitro-6-octan-2-ylphenol |
|---|
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 377.4ºC at 760 mmHg |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.31900 |
| Flash Point | 149.3ºC |
| Exact Mass | 296.13700 |
| PSA | 111.87000 |
| LogP | 5.32890 |
| Index of Refraction | 1.556 |
| InChIKey | DVOCCVCLRHDYOB-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| HS Code | 2908999090 |
|---|
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |