3-(2-furyl)-2-phenyl-prop-2-enoic acid structure
|
Common Name | 3-(2-furyl)-2-phenyl-prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 4484-53-1 | Molecular Weight | 214.21700 | |
| Density | 1.26g/cm3 | Boiling Point | 307.5ºC at 760 mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.8ºC | |
| Name | 3-(furan-2-yl)-2-phenylprop-2-enoic acid |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 307.5ºC at 760 mmHg |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.21700 |
| Flash Point | 139.8ºC |
| Exact Mass | 214.06300 |
| PSA | 50.44000 |
| LogP | 2.90480 |
| Index of Refraction | 1.634 |
| InChIKey | NXFJMNHCFFZDTM-FMIVXFBMSA-N |
| SMILES | O=C(O)C(=Cc1ccco1)c1ccccc1 |
|
~%
3-(2-furyl)-2-p... CAS#:4484-53-1 |
| Literature: Ward, William J.; McEven, William E. Journal of Organic Chemistry, 1990 , vol. 55, # 2 p. 493 - 500 |
|
~%
3-(2-furyl)-2-p... CAS#:4484-53-1 |
| Literature: Schering Corp. Patent: US2594355 , 1947 ; |
|
~%
3-(2-furyl)-2-p... CAS#:4484-53-1 |
| Literature: Karminski-Zamola, G.; Bajic, M. Synthetic Communications, 1989 , vol. 19, # 7,8 p. 1325 - 1334 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |