(2,3,4,5,6-pentachlorophenyl) prop-2-enoate structure
|
Common Name | (2,3,4,5,6-pentachlorophenyl) prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 4513-43-3 | Molecular Weight | 320.38400 | |
| Density | 1.615g/cm3 | Boiling Point | 399.62ºC at 760 mmHg | |
| Molecular Formula | C9H3Cl5O2 | Melting Point | 80-81ºC | |
| MSDS | N/A | Flash Point | 168.649ºC | |
| Name | (2,3,4,5,6-pentachlorophenyl) prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.615g/cm3 |
|---|---|
| Boiling Point | 399.62ºC at 760 mmHg |
| Melting Point | 80-81ºC |
| Molecular Formula | C9H3Cl5O2 |
| Molecular Weight | 320.38400 |
| Flash Point | 168.649ºC |
| Exact Mass | 317.85800 |
| PSA | 26.30000 |
| LogP | 5.04500 |
| Index of Refraction | 1.584 |
| InChIKey | KWQJKAHZHOILKK-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2916129000 |
|
~69%
(2,3,4,5,6-pent... CAS#:4513-43-3 |
| Literature: Guo-Dong, Fu; Fang, Yao; Zhigang, Li; Xinsong, Li Journal of Materials Chemistry, 2008 , vol. 18, # 8 p. 859 - 867 |
|
~%
(2,3,4,5,6-pent... CAS#:4513-43-3 |
| Literature: Ismail,R.M. Journal fuer Praktische Chemie (Leipzig), 1970 , vol. 312, p. 389 - 393 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Acrylsaeure-pentachlorphenylester |
| 2-Propenoic acid,pentachlorophenyl ester |
| PENTACHLOROPHENYL ACRYLATE |