p-Xylylenediphosphonic Acid structure
|
Common Name | p-Xylylenediphosphonic Acid | ||
|---|---|---|---|---|
| CAS Number | 4546-06-9 | Molecular Weight | 266.12500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12O6P2 | Melting Point | 280 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [4-(phosphonomethyl)phenyl]methylphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 280 °C |
|---|---|
| Molecular Formula | C8H12O6P2 |
| Molecular Weight | 266.12500 |
| Exact Mass | 266.01100 |
| PSA | 134.68000 |
| LogP | 1.04200 |
| InChIKey | ZURHBENZJDSCRG-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)Cc1ccc(CP(=O)(O)O)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P305 + P351 + P338-P337 + P313 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| p-xylenediphosphonic acid |
| p-xylylenediphosphonate acid |