N6-benzoyl-2'-Deoxyadenosine
N6-benzoyl-2'-Deoxyadenosine structure
|
Common Name | N6-benzoyl-2'-Deoxyadenosine | ||
|---|---|---|---|---|
| CAS Number | 4546-72-9 | Molecular Weight | 355.34800 | |
| Density | 1.61 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H17N5O4 | Melting Point | 120-122ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Benzoyl-2'-deoxy-adenosine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.61 g/cm3 |
|---|---|
| Melting Point | 120-122ºC |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.34800 |
| Exact Mass | 355.12800 |
| PSA | 122.39000 |
| LogP | 0.79230 |
| InChIKey | PIXHJAPVPCVZSV-YNEHKIRRSA-N |
| SMILES | O=C(Nc1ncnc2c1ncn2C1CC(O)C(CO)O1)c1ccccc1 |
| Storage condition | Store at 0°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 8 | |
CAS#:65-85-0
CAS#:958-09-8
CAS#:64325-78-6
CAS#:98-88-4
CAS#:64723-02-0
CAS#:64911-19-9
CAS#:961-07-9
CAS#:4005-49-6
CAS#:253277-01-9
CAS#:211919-87-8
CAS#:68498-25-9
CAS#:36792-88-8
CAS#:3413-66-9
CAS#:51549-39-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-benzoyl-2'-deoxyadenosine |
| N-chloroacetyl-benzamide |
| N-benzoyl-chloroacetamide |
| MFCD00009628 |
| 6-N-Benzoyl-2'-deoxyadenosine |
| benzoyl-chloroacetyl-amine |
| Benzoyl-chloracetyl-amin |
| 6N-benzoyldeoxyadenosine |
| N6-benzoyldeoxyadenosine |
| N-benzoyl-2-chloroacetamide |
| EINECS 224-903-6 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does N-Benzoyl-2'-deoxy-adenosine have? |
| A: English synonyms of N-Benzoyl-2'-deoxy-adenosine: N-benzoyl-2'-deoxyadenosine, N-chloroacetyl-benzamide, N-benzoyl-chloroacetamide, MFCD00009628, 6-N-Benzoyl-2'-deoxyadenosine, benzoyl-chloroacetyl-amine, Benzoyl-chloracetyl-amin, 6N-benzoyldeoxyadenosine, N6-benzoyldeoxyadenosine, N-benzoyl-2-chloroacetamide, EINECS 224-903-6. |
| Q: What is the LogP of N-Benzoyl-2'-deoxy-adenosine? |
| A: LogP of N-Benzoyl-2'-deoxy-adenosine is 0.79230. |
| Q: What is the CAS number of N-Benzoyl-2'-deoxy-adenosine? |
| A: CAS number of N-Benzoyl-2'-deoxy-adenosine is 4546-72-9. |
| Q: What is the SMILES notation of N-Benzoyl-2'-deoxy-adenosine? |
| A: SMILES notation of N-Benzoyl-2'-deoxy-adenosine is O=C(Nc1ncnc2c1ncn2C1CC(O)C(CO)O1)c1ccccc1. |
| Q: What is the melting point of N-Benzoyl-2'-deoxy-adenosine? |
| A: Melting point of N-Benzoyl-2'-deoxy-adenosine is 120-122ºC. |
| Q: What are the upstream materials of N-Benzoyl-2'-deoxy-adenosine? |
| A: Related upstream materials(CAS) of N-Benzoyl-2'-deoxy-adenosine: 65-85-0;958-09-8;64325-78-6;98-88-4;64723-02-0;64911-19-9;961-07-9;4005-49-6;253277-01-9. |
| Q: What is the English name of N-Benzoyl-2'-deoxy-adenosine? |
| A: The English name of N-Benzoyl-2'-deoxy-adenosine is N-Benzoyl-2'-deoxy-adenosine. |
| Q: What is the molecular formula of N-Benzoyl-2'-deoxy-adenosine? |
| A: Molecular formula of N-Benzoyl-2'-deoxy-adenosine is C17H17N5O4. |
| Q: What are the storage conditions for N-Benzoyl-2'-deoxy-adenosine? |
| A: Storage conditions for N-Benzoyl-2'-deoxy-adenosine: Store at 0°C. |
| Q: What is the InChIKey of N-Benzoyl-2'-deoxy-adenosine? |
| A: InChIKey of N-Benzoyl-2'-deoxy-adenosine is PIXHJAPVPCVZSV-YNEHKIRRSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |