4-methyl-N-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene]amino]benzenesulfonamide structure
|
Common Name | 4-methyl-N-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene]amino]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 4573-49-3 | Molecular Weight | 320.45000 | |
| Density | 1.24g/cm3 | Boiling Point | 434.9ºC at 760 mmHg | |
| Molecular Formula | C17H24N2O2S | Melting Point | 162-165ºC(lit.) | |
| MSDS | N/A | Flash Point | 216.8ºC | |
| Name | 4-methyl-N-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene]amino]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 434.9ºC at 760 mmHg |
| Melting Point | 162-165ºC(lit.) |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.45000 |
| Flash Point | 216.8ºC |
| Exact Mass | 320.15600 |
| PSA | 66.91000 |
| LogP | 4.94720 |
| Index of Refraction | 1.61 |
| InChIKey | DPXSCASCDWIKEX-RBQFCQKASA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=C2CC3CCC2(C)C3(C)C)cc1 |
|
~%
4-methyl-N-[(Z)... CAS#:4573-49-3 |
| Literature: Bamford; Stevens Journal of the Chemical Society, 1952 , p. 4735,4738 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| (1R)-camphor p-tosylhydrazone |
| MFCD00075257 |