3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one
![3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one Structure](https://image.chemsrc.com/caspic/311/4641-33-2.png)
3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one structure
|
Common Name | 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 4641-33-2 | Molecular Weight | 495.44000 | |
| Density | 1.22g/cm3 | Boiling Point | 635ºC at 760 mmHg | |
| Molecular Formula | C28H28Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 635ºC at 760 mmHg |
| Molecular Formula | C28H28Cl2N2O2 |
| Molecular Weight | 495.44000 |
| Flash Point | 337.9ºC |
| Exact Mass | 494.15300 |
| PSA | 44.12000 |
| LogP | 7.57210 |
| Index of Refraction | 1.604 |
| InChIKey | IDHNDZCLHZBUHJ-UHFFFAOYSA-N |
| SMILES | CCc1cc(OCCCCCCn2c(-c3ccc(Cl)cc3)nc3ccccc3c2=O)ccc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:90-98-2
CAS#:1871-38-1
CAS#:24252-90-2
CAS#:27076-50-2
CAS#:53-86-1
CAS#:873073-30-4
CAS#:6264-29-5
CAS#:3229-70-7
CAS#:117380-98-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-Chlorbenzoat-ion |
| p-chlorobenzoate anion |
| 4-chlorobenzoate ion |
| p-chlorobenzoate |
| 4-chloro-benzoic acid,deprotonated form |
| p-Chlorobenzoat |
| 4-chlorobenzoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one? |
| A: Molecular weight of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one is 495.44000. |
| Q: What is the polar surface area (PSA) of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one? |
| A: Polar surface area (PSA) of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one is 44.12000. |
| Q: What is the CAS number of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one? |
| A: CAS number of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one is 4641-33-2. |
| Q: What English synonyms does 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one have? |
| A: English synonyms of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one: p-Chlorbenzoat-ion, p-chlorobenzoate anion, 4-chlorobenzoate ion, p-chlorobenzoate, 4-chloro-benzoic acid,deprotonated form, p-Chlorobenzoat, 4-chlorobenzoate. |
| Q: What is the Chinese name of 4641-33-2? |
| A: Chinese name of 4641-33-2 is 4641-33-2. |
| Q: What is the English name of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one? |
| A: The English name of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one is 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one. |
| Q: What is the boiling point of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one? |
| A: Boiling point of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one is 635ºC at 760 mmHg. |
| Q: What is the InChIKey of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one? |
| A: InChIKey of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one is IDHNDZCLHZBUHJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one? |
| A: Molecular formula of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one is C28H28Cl2N2O2. |
| Q: What are the upstream materials of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one? |
| A: Related upstream materials(CAS) of 3-[6-(4-chloro-3-ethylphenoxy)hexyl]-2-(4-chlorophenyl)quinazolin-4-one: 90-98-2;1871-38-1;24252-90-2;27076-50-2;53-86-1;873073-30-4;6264-29-5;3229-70-7;117380-98-0. |