Chinova acid structure
|
Common Name | Chinova acid | ||
|---|---|---|---|---|
| CAS Number | 465-74-7 | Molecular Weight | 486.683 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 621.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H46O5 | Melting Point | 298°C (rough estimate) | |
| MSDS | N/A | Flash Point | 343.9±28.0 °C | |
Use of Chinova acidQuinovic acid is a natural product that can be isolated from Zygophyllum fabago L[1]. |
| Name | Quinovic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Quinovic acid is a natural product that can be isolated from Zygophyllum fabago L[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. He, J., et al. Four new compounds from Zygophyllum fabago L. Phytochemistry Letters, 15, 116–120. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 621.9±55.0 °C at 760 mmHg |
| Melting Point | 298°C (rough estimate) |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.683 |
| Flash Point | 343.9±28.0 °C |
| Exact Mass | 486.334534 |
| PSA | 94.83000 |
| LogP | 7.40 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | OJUYFGQEMPENCE-DPKHZRJYSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C(=O)O)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C |
| Hazard Codes | Xi |
|---|
| (3β)-3-Hydroxyurs-12-ene-27,28-dioic acid |
| quinovic acid |
| Chinovic acid |
| Quinovaic acid |
| 3-β-Hydroxyurs-12-ene-27,28-dioic acid |
| Urs-12-ene-27,28-dioic acid, 3-hydroxy-, (3β)- |
| Chinova acid |
| UNII:9JP167T0ZN |