Marrubiin structure
|
Common Name | Marrubiin | ||
|---|---|---|---|---|
| CAS Number | 465-92-9 | Molecular Weight | 332.43400 | |
| Density | 1.152g/cm3 | Boiling Point | 465.2ºC at 760mmHg | |
| Molecular Formula | C20H28O4 | Melting Point | 159-162ºC | |
| MSDS | N/A | Flash Point | 235.2ºC | |
Use of MarrubiinMarrubiin, isolated from Marrubium vulgare, exhibits vasorelaxant and antioedematogenic activity. Marrubiin alleviates diabetic symptoms in animals[1][2][3]. |
| Name | marrubiin |
|---|---|
| Synonym | More Synonyms |
| Description | Marrubiin, isolated from Marrubium vulgare, exhibits vasorelaxant and antioedematogenic activity. Marrubiin alleviates diabetic symptoms in animals[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 465.2ºC at 760mmHg |
| Melting Point | 159-162ºC |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.43400 |
| Flash Point | 235.2ºC |
| Exact Mass | 332.19900 |
| PSA | 59.67000 |
| LogP | 3.72120 |
| Vapour Pressure | 1.87E-09mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | HQLLRHCTVDVUJB-OBHOOXMTSA-N |
| SMILES | CC1CC2OC(=O)C3(C)CCCC(C)(C23)C1(O)CCc1ccoc1 |
| Marrubiin I |
| MarrubiuM bitter |