Stigmasta-5,22-dien-3.beta.-ol, acetate
Stigmasta-5,22-dien-3.beta.-ol, acetate structure
|
Common Name | Stigmasta-5,22-dien-3.beta.-ol, acetate | ||
|---|---|---|---|---|
| CAS Number | 4651-48-3 | Molecular Weight | 454.72800 | |
| Density | 0.99 g/cm3 | Boiling Point | 513.6ºC at 760mmHg | |
| Molecular Formula | C31H50O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.5ºC | |
Summary: Stigmasterol 3-O-acetate (Chinese name: 醋酸豆甾醇), with the chemical name Stigmasta-5,22-dien-3.beta.-ol, acetate, has a CAS number of 4651-48-3. The molecular formula is C31H50O2 and the molecular weight is 454.72800. Its density is 0.99 g/cm3 and the boiling point is 513.6ºC at 760mmHg. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | stigmasterol 3-O-acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.99 g/cm3 |
|---|---|
| Boiling Point | 513.6ºC at 760mmHg |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.72800 |
| Flash Point | 261.5ºC |
| Exact Mass | 454.38100 |
| PSA | 26.30000 |
| LogP | 8.37160 |
| Index of Refraction | 1.521 |
| InChIKey | IZEUIYYDWBKERE-ZRODXFKISA-N |
| SMILES | CCC(C=CC(C)C1CCC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC12C)C(C)C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 6 | |
CAS#:83-48-7
CAS#:108-24-7
CAS#:33761-96-5
CAS#:33644-13-2
CAS#:1371577-45-5
CAS#:19716-26-8
CAS#:915-05-9
CAS#:53-43-0
CAS#:83-46-5
CAS#:10211-88-8
CAS#:167958-89-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| STIGMASTEROL ACETATE |
| 3beta-Acetoxystigmasta-5,22-diene |
| 3BETA-ACETOXY-5,22-STIGMASTADIENE |
| 3.β.-Acetoxystigmasta-5,22-diene |
| stigmasteryl acetate |
| Stigmasta-5,22-dien-3beta-ol,acetate |
| (22E)-Stigmasta-5,22-dien-3-yl acetate |
| Stigmasterol 3-Acetate |
| stigmasta-5,22-dien-3-acetate |
| Stigmasterolacetatecrystalline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of stigmasterol 3-O-acetate? |
| A: InChIKey of stigmasterol 3-O-acetate is IZEUIYYDWBKERE-ZRODXFKISA-N. |
| Q: What is the polar surface area (PSA) of stigmasterol 3-O-acetate? |
| A: Polar surface area (PSA) of stigmasterol 3-O-acetate is 26.30000. |
| Q: What English synonyms does stigmasterol 3-O-acetate have? |
| A: English synonyms of stigmasterol 3-O-acetate: STIGMASTEROL ACETATE, 3beta-Acetoxystigmasta-5,22-diene, 3BETA-ACETOXY-5,22-STIGMASTADIENE, 3.β.-Acetoxystigmasta-5,22-diene, stigmasteryl acetate, Stigmasta-5,22-dien-3beta-ol,acetate, (22E)-Stigmasta-5,22-dien-3-yl acetate, Stigmasterol 3-Acetate, stigmasta-5,22-dien-3-acetate, Stigmasterolacetatecrystalline. |
| Q: What are the downstream products of stigmasterol 3-O-acetate? |
| A: Related downstream products(CAS) of stigmasterol 3-O-acetate: 915-05-9;53-43-0;83-48-7;83-46-5;10211-88-8;167958-89-6. |
| Q: What is the boiling point of stigmasterol 3-O-acetate? |
| A: Boiling point of stigmasterol 3-O-acetate is 513.6ºC at 760mmHg. |
| Q: What is the CAS number of stigmasterol 3-O-acetate? |
| A: CAS number of stigmasterol 3-O-acetate is 4651-48-3. |
| Q: What is the SMILES notation of stigmasterol 3-O-acetate? |
| A: SMILES notation of stigmasterol 3-O-acetate is CCC(C=CC(C)C1CCC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC12C)C(C)C. |
| Q: What is the LogP of stigmasterol 3-O-acetate? |
| A: LogP of stigmasterol 3-O-acetate is 8.37160. |
| Q: What are the upstream materials of stigmasterol 3-O-acetate? |
| A: Related upstream materials(CAS) of stigmasterol 3-O-acetate: 83-48-7;108-24-7;33761-96-5;33644-13-2;1371577-45-5;19716-26-8. |
| Q: What is the English name of stigmasterol 3-O-acetate? |
| A: The English name of stigmasterol 3-O-acetate is stigmasterol 3-O-acetate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |