Gly-Leu-Met-NH2 structure
|
Common Name | Gly-Leu-Met-NH2 | ||
|---|---|---|---|---|
| CAS Number | 4652-64-6 | Molecular Weight | 318.43600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H26N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Gly-Leu-Met-NH2Gly-Leu-Met-NH2 is a C-terminal tripeptide of Substance P (Substance P (HY-P0201)). Substance P is a neuropeptide[1]. |
| Name | (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]-4-methylpentanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Gly-Leu-Met-NH2 is a C-terminal tripeptide of Substance P (Substance P (HY-P0201)). Substance P is a neuropeptide[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H26N4O3S |
|---|---|
| Molecular Weight | 318.43600 |
| Exact Mass | 318.17300 |
| PSA | 152.61000 |
| LogP | 1.38160 |
| InChIKey | RLXSTJVYBMNHEP-UWVGGRQHSA-N |
| SMILES | CSCCC(NC(=O)C(CC(C)C)NC(=O)CN)C(N)=O |
| L-Methioninamide,glycyl-L-leucyl |