Benzeneacetic acid,2-bromo-4,5-dimethoxy structure
|
Common Name | Benzeneacetic acid,2-bromo-4,5-dimethoxy | ||
|---|---|---|---|---|
| CAS Number | 4697-62-5 | Molecular Weight | 275.09600 | |
| Density | 1.519g/cm3 | Boiling Point | 377.1ºC at 760mmHg | |
| Molecular Formula | C10H11BrO4 | Melting Point | 94ºC | |
| MSDS | N/A | Flash Point | 181.8ºC | |
| Name | 2-Bromo-4,5-dimethoxyphenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.519g/cm3 |
|---|---|
| Boiling Point | 377.1ºC at 760mmHg |
| Melting Point | 94ºC |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.09600 |
| Flash Point | 181.8ºC |
| Exact Mass | 273.98400 |
| PSA | 55.76000 |
| LogP | 2.09340 |
| Index of Refraction | 1.558 |
| InChIKey | MDOLAGJKKZEHHW-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)c(CC(=O)O)cc1OC |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2918990090 |
|
~96%
Benzeneacetic a... CAS#:4697-62-5 |
| Literature: Synthesis, , # 8 p. 1375 - 1385 |
|
~%
Benzeneacetic a... CAS#:4697-62-5 |
| Literature: Journal of the American Chemical Society, , vol. 59, p. 1541,1545 |
|
~%
Benzeneacetic a... CAS#:4697-62-5 |
| Literature: Journal of the American Chemical Society, , vol. 59, p. 1541,1545 |
|
~%
Benzeneacetic a... CAS#:4697-62-5 |
| Literature: Journal of the American Chemical Society, , vol. 59, p. 1541,1545 |
|
~%
Benzeneacetic a... CAS#:4697-62-5 |
| Literature: Synthesis, , # 8 p. 1375 - 1385 |
| Precursor 5 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(2-bromo-4,5-dimethoxyphenyl)acetic acid |
| MFCD00016819 |