20-Hydroxydammar-24-en-3-one structure
|
Common Name | 20-Hydroxydammar-24-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 471-69-2 | Molecular Weight | 442.717 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 527.3±23.0 °C at 760 mmHg | |
| Molecular Formula | C30H50O2 | Melting Point | 133-135ºC(lit.) | |
| MSDS | N/A | Flash Point | 222.6±15.2 °C | |
Use of 20-Hydroxydammar-24-en-3-oneDipterocarpol is a dammarane-type triterpenoid. Dipterocarpol is substrate of the bacterial steroid-hydroxylase CYP106A2[1]. |
| Name | (5R,8R,9R,10R,13R,14R,17S)-17-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Dipterocarpol is a dammarane-type triterpenoid. Dipterocarpol is substrate of the bacterial steroid-hydroxylase CYP106A2[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 527.3±23.0 °C at 760 mmHg |
| Melting Point | 133-135ºC(lit.) |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.717 |
| Flash Point | 222.6±15.2 °C |
| Exact Mass | 442.381073 |
| PSA | 37.30000 |
| LogP | 8.77 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | NJICGAVMYWKCMW-CKHDAVRFSA-N |
| SMILES | CC(C)=CCCC(C)(O)C1CCC2(C)C1CCC1C3(C)CCC(=O)C(C)(C)C3CCC12C |
| hydroxydammarenone II |
| Dipterocarpol |
| 20-Hydroxydammar-24-en-3-one |
| 20-hydroxydammar-24-ene-3-one |
| Dammar-24-en-3-one, 20-hydroxy- |