Masticadielic acid structure
|
Common Name | Masticadielic acid | ||
|---|---|---|---|---|
| CAS Number | 472-30-0 | Molecular Weight | 456.70 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 567.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.9±26.6 °C | |
Use of Masticadielic acidMasticadienolic acid is an antitumor agent via increasing the production of nitric oxide (NO). Masticadienolic acid also increases the release of NO in resting macrophages[1]. |
| Name | (3β,13α,14β,17α,20S,24Z)-3-Hydroxylanosta-7,24-dien-26-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Masticadienolic acid is an antitumor agent via increasing the production of nitric oxide (NO). Masticadienolic acid also increases the release of NO in resting macrophages[1]. |
|---|---|
| Related Catalog | |
| Target |
Nitric oxide (NO) Production |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 567.2±50.0 °C at 760 mmHg |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.70 |
| Flash Point | 310.9±26.6 °C |
| Exact Mass | 456.360352 |
| PSA | 57.53000 |
| LogP | 9.40 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | UILQHUKSFUOOLH-UHFFFAOYSA-N |
| SMILES | CC(=CCCC(C)C1CCC2(C)C3=CCC4C(C)(C)C(O)CCC4(C)C3CCC12C)C(=O)O |
| Hazard Codes | Xi |
|---|
|
~%
Masticadielic acid CAS#:472-30-0 |
| Literature: Barton; Seoane Journal of the Chemical Society, 1956 , p. 4150,4156 |
|
~%
Masticadielic acid CAS#:472-30-0 |
| Literature: Rao; Bose Transactions of the Bose Research Institute (Calcutta), 1957 , vol. 21, p. 23,28 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| cyclolaudenol |
| Lanosta-7,24-dien-26-oic acid, 3-hydroxy-, (3β,13α,14β,17α,20S,24Z)- |
| (3β,13α,14β,17α,20S,24Z)-3-Hydroxylanosta-7,24-dien-26-oic acid |
| Cyclolandenol |
| 24Z-masticadienolic acid |