Phenol,4-(3,4-dihydro-2,2,4-trimethyl-2H-1-benzopyran-4-yl) structure
|
Common Name | Phenol,4-(3,4-dihydro-2,2,4-trimethyl-2H-1-benzopyran-4-yl) | ||
|---|---|---|---|---|
| CAS Number | 472-41-3 | Molecular Weight | 268.35000 | |
| Density | 1.087g/cm3 | Boiling Point | 390.7ºC at 760mmHg | |
| Molecular Formula | C18H20O2 | Melting Point | 140ºC | |
| MSDS | N/A | Flash Point | 166.7ºC | |
| Name | 4-(2,2,4-Trimethylchroman-4-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 390.7ºC at 760mmHg |
| Melting Point | 140ºC |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.35000 |
| Flash Point | 166.7ºC |
| Exact Mass | 268.14600 |
| PSA | 29.46000 |
| LogP | 4.25930 |
| Vapour Pressure | 3.42E-06mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | KXYDGGNWZUHESZ-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C)(c2ccc(O)cc2)c2ccccc2O1 |
| Storage condition | 2-8°C |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(2,2,4-trimethyl-3H-chromen-4-yl)phenol |
| 3,4-DIHYDRO-4-(4-HYDROXYPHENYL)-2,2,4-TRIMETHYL-2H-1-BENZOPYRAN |