Tolbutamide Sodium structure
|
Common Name | Tolbutamide Sodium | ||
|---|---|---|---|---|
| CAS Number | 473-41-6 | Molecular Weight | 270.34800 | |
| Density | 1.184g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tolbutamide SodiumTolbutamide sodium is a potent and orally active antidiabetic agent. Tolbutamide sodium induces apoptosis in a Ca2+ dependent manner in pancreatic β-cells. Tolbutamide sodium has the potential for the research of non-insulin-dependent diabetes mellitus[1][2]. |
| Name | sodium,butylcarbamoyl-(4-methylphenyl)sulfonylazanide |
|---|---|
| Synonym | More Synonyms |
| Description | Tolbutamide sodium is a potent and orally active antidiabetic agent. Tolbutamide sodium induces apoptosis in a Ca2+ dependent manner in pancreatic β-cells. Tolbutamide sodium has the potential for the research of non-insulin-dependent diabetes mellitus[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.184g/cm3 |
|---|---|
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.34800 |
| Exact Mass | 270.10400 |
| PSA | 87.14000 |
| LogP | 3.45910 |
| Index of Refraction | 1.532 |
| InChIKey | QKHDBRQBSNZFAK-UHFFFAOYSA-M |
| SMILES | CCCCNC(=O)[N-]S(=O)(=O)c1ccc(C)cc1.[Na+] |
| Orinase Diagnostic |
| Sodium tolbutamide |
| Sodium butamide |
| Urea,1-butyl-3-(p-tolylsulfonyl)-,sodium salt |
| TOLBUTAMIDE SODIUM |
| Sodium orinase |
| 1-Butyl-3-(p-tolylsulfonyl)urea monosodium salt |
| Tolbutamide sodium salt |
| Tolbutamide sodium,sterile |
| p-Toluenosulfonylbutylomocznik,sol sodowa [Polish] |