3,5-dihydroxy-4-[(3,4,5-trihydroxybenzoyl)oxy]benzoic acid
![3,5-dihydroxy-4-[(3,4,5-trihydroxybenzoyl)oxy]benzoic acid Structure](https://image.chemsrc.com/caspic/125/47307-06-2.png)
3,5-dihydroxy-4-[(3,4,5-trihydroxybenzoyl)oxy]benzoic acid structure
|
Common Name | 3,5-dihydroxy-4-[(3,4,5-trihydroxybenzoyl)oxy]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 47307-06-2 | Molecular Weight | 322.22400 | |
| Density | 1.815g/cm3 | Boiling Point | 689.4ºC at 760mmHg | |
| Molecular Formula | C14H10O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7ºC | |
Summary: 3,5-Dihydroxy-4-[(3,4,5-trihydroxybenzoyl)oxy]benzoic acid (Chinese name: 3,5-二羟基-4-(3,4,5-三羟基苯甲酰氧基)苯甲酸, CAS number: 47307-06-2, molecular formula: C14H10O9), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.815g/cm3 |
|---|---|
| Boiling Point | 689.4ºC at 760mmHg |
| Molecular Formula | C14H10O9 |
| Molecular Weight | 322.22400 |
| Flash Point | 263.7ºC |
| Exact Mass | 322.03200 |
| PSA | 164.75000 |
| LogP | 1.13200 |
| Index of Refraction | 1.776 |
| InChIKey | OVPHIYQDYJLKEW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c(O)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,5-dihydroxy-4... CAS#:47307-06-2
Detail
Learn More
|
| Literature: Maeda, Hajime; Kakoki, Narumi; Ayabe, Mami; Koga, Yuki; Oribe, Tomoko; Matsuo, Yosuke; Tanaka, Takashi; Kouno, Isao Phytochemistry, 2011 , vol. 72, # 8 p. 796 - 803 |
|
~%
3,5-dihydroxy-4... CAS#:47307-06-2 |
| Literature: Verzele, M.; Delahaye, P.; Dijck, J. Van Bulletin des Societes Chimiques Belges, 1983 , vol. 92, # 2 p. 181 - 186 |
![Benzoic acid,3,4-dihydroxy-5-[(3,4,5-trihydroxybenzoyl)oxy] structure](https://image.chemsrc.com/caspic/343/536-08-3.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Galloyl-gallussaeure |
| 4-galloyloxy-3,5-dihydroxy-benzoic acid |
| 4-Galloyloxy-3,5-dihydroxy-benzoesaeure |
| EINECS 256-307-7 |
| p-digallic acid |
| para digallic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid? |
| A: Boiling point of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid is 689.4ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid? |
| A: Polar surface area (PSA) of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid is 164.75000. |
| Q: What is the CAS number of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid? |
| A: CAS number of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid is 47307-06-2. |
| Q: What is the English name of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid? |
| A: The English name of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid is 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid. |
| Q: What is the SMILES notation of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid? |
| A: SMILES notation of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid is O=C(O)c1cc(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c(O)c1. |
| Q: What are the upstream materials of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid? |
| A: Related upstream materials(CAS) of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid: 14937-32-7;536-08-3. |
| Q: What is the Chinese name of 47307-06-2? |
| A: Chinese name of 47307-06-2 is 47307-06-2. |
| Q: What is the molecular weight of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid? |
| A: Molecular weight of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid is 322.22400. |
| Q: What is the LogP of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid? |
| A: LogP of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid is 1.13200. |
| Q: What is the InChIKey of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid? |
| A: InChIKey of 3,5-dihydroxy-4-(3,4,5-trihydroxybenzoyl)oxybenzoic acid is OVPHIYQDYJLKEW-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |