1,2,3,4,6-O-Pentagalloylglucose structure
|
Common Name | 1,2,3,4,6-O-Pentagalloylglucose | ||
|---|---|---|---|---|
| CAS Number | 14937-32-7 | Molecular Weight | 940.677 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | 1365.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C41H32O26 | Melting Point | >250ºC dec. | |
| MSDS | N/A | Flash Point | 410.4±27.8 °C | |
Use of 1,2,3,4,6-O-Pentagalloylglucose1,2,3,4,6-Penta-O-galloyl-β-D-glucopyranose is a gallotannin isolated from various plants. It suppressed interleukin (IL)-4 induced signal pathway in B cell, and inhibited IgE production partially caused by increasing a population of Treg cells in conjunction with Treg-inducing factors. |
| Name | 1,2,3,4,6-pentakis-O-galloyl-β-D-glucose |
|---|---|
| Synonym | More Synonyms |
| Description | 1,2,3,4,6-Penta-O-galloyl-β-D-glucopyranose is a gallotannin isolated from various plants. It suppressed interleukin (IL)-4 induced signal pathway in B cell, and inhibited IgE production partially caused by increasing a population of Treg cells in conjunction with Treg-inducing factors. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 1365.7±65.0 °C at 760 mmHg |
| Melting Point | >250ºC dec. |
| Molecular Formula | C41H32O26 |
| Molecular Weight | 940.677 |
| Flash Point | 410.4±27.8 °C |
| Exact Mass | 940.118164 |
| PSA | 444.18000 |
| LogP | 8.51 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.870 |
| InChIKey | QJYNZEYHSMRWBK-NIKIMHBISA-N |
| SMILES | O=C(OCC1OC(OC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c2cc(O)c(O)c(O)c2)C1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
| Stability | Hygroscopic |
| Water Solubility | DMSO: ≥20mg/mL |
| Safety Phrases | 24/25 |
|---|---|
| HS Code | 2912499000 |
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| β-D-Glucopyranose, pentakis(3,4,5-trihydroxybenzoate) |
| 1,2,3,4,6-Pentakis-O-galloyl-β-D-glucose |
| 1,2,3,4,6-O-pentagalloylglucose |
| 1,2,3,4,6-pentakis-O-galloyl-beta-D-glucose |
| [(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| 1,2,3,4,6-Pentagalloyl glucose |
| Pentagalloylglucose |
| 1,2,3,4,6-Penta-O-galloyl-β-D-glucopyranose |
| 1,2,3,4,6-Pentakis-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranose |
| 1,2,3,4,6-Penta-O-galloyl-b-D-glucose |
| β-1,2,3,4,6-Pentagalloylglucose |