Lumisterol structure
|
Common Name | Lumisterol | ||
|---|---|---|---|---|
| CAS Number | 474-69-1 | Molecular Weight | 396.64800 | |
| Density | 1g/cm3 | Boiling Point | 501.5ºC at 760mmHg | |
| Molecular Formula | C28H44O | Melting Point | 118ºC | |
| MSDS | N/A | Flash Point | 216.3ºC | |
Use of LumisterolLumisterol (9β,10α-Ergosterol), a steroid compound, is the (9β,10α)-stereoisomer of Ergosterol. Lumisterol is a photoprotective agent against UVB-induced DNA damage and anti-proliferative activities[1]. |
| Name | (3β,9β,10α,22E)-Ergosta-5,7,22-trien-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Lumisterol (9β,10α-Ergosterol), a steroid compound, is the (9β,10α)-stereoisomer of Ergosterol. Lumisterol is a photoprotective agent against UVB-induced DNA damage and anti-proliferative activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 501.5ºC at 760mmHg |
| Melting Point | 118ºC |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.64800 |
| Flash Point | 216.3ºC |
| Exact Mass | 396.33900 |
| PSA | 20.23000 |
| LogP | 7.33080 |
| Vapour Pressure | 3.7E-12mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | DNVPQKQSNYMLRS-YAPGYIAOSA-N |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C3=CC=C4CC(O)CCC4(C)C3CCC21C |
| Storage condition | -20°C |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| Linolensaeurechlorid |
| Linolenoyl chloride,tech. |
| linolenic acid chloride |
| CIS-LINOLENOYL CHLORIDE |
| Lumisterol |
| cis,cis,cis-9,12,15-octadecatrienoyl chloride |
| Lumisterol2 |