benzene-1,2,3,4-tetracarboxylic acid
benzene-1,2,3,4-tetracarboxylic acid structure
|
Common Name | benzene-1,2,3,4-tetracarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 476-73-3 | Molecular Weight | 254.15000 | |
| Density | 1.821g/cm3 | Boiling Point | 572.2ºC at 760mmHg | |
| Molecular Formula | C10H6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4-Benzenetetracarboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.821g/cm3 |
|---|---|
| Boiling Point | 572.2ºC at 760mmHg |
| Molecular Formula | C10H6O8 |
| Molecular Weight | 254.15000 |
| Flash Point | 313.9ºC |
| Exact Mass | 254.00600 |
| PSA | 149.20000 |
| LogP | 0.47940 |
| Vapour Pressure | 6.24E-14mmHg at 25°C |
| Index of Refraction | 1.7 |
| InChIKey | GCAIEATUVJFSMC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 2 | |
CAS#:5325-97-3![2,3,7,8-tetrahydro-2,7-diethylbenzo[1,2-c:3,4-c']dipyrrole-1,6-dione Structure](https://image.chemsrc.com/caspic/165/85068-01-5.png)
CAS#:85068-01-5
CAS#:4488-40-8
CAS#:605-70-9
CAS#:571-58-4
CAS#:5463-50-3
CAS#:861292-77-5![2,2-diethyl-cyclopenta[a]naphthalene-1,3-dione Structure](https://image.chemsrc.com/caspic/041/857552-11-5.png)
CAS#:857552-11-5
CAS#:861566-94-1
CAS#:1079-71-6
CAS#:488-23-3
CAS#:3451-02-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-iodo-3,4-dibutyl-5-trimethylsilylethynylthiophene |
| Thiophene,3,4-dibutyl-2-iodo-5-[2-(trimethylsilyl)ethynyl] |
| 1,2,3,4-benzenetetracaboxylic acid |
| benzene-1,2,3,4-tetracarboxylic acid |
| benzenetetracarboxylic acid |
| 3,4-dicarboxyphthalic acid |
| Benzol-1,2,3,4-tetracarbonsaeure |
| 3,4-dibutyl-2-iodo-5-trimethylsilylethynylthiophene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,2,3,4-Benzenetetracarboxylic acid? |
| A: Molecular weight of 1,2,3,4-Benzenetetracarboxylic acid is 254.15000. |
| Q: What is the boiling point of 1,2,3,4-Benzenetetracarboxylic acid? |
| A: Boiling point of 1,2,3,4-Benzenetetracarboxylic acid is 572.2ºC at 760mmHg. |
| Q: What is the Chinese name of 476-73-3? |
| A: Chinese name of 476-73-3 is 476-73-3. |
| Q: What is the InChIKey of 1,2,3,4-Benzenetetracarboxylic acid? |
| A: InChIKey of 1,2,3,4-Benzenetetracarboxylic acid is GCAIEATUVJFSMC-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1,2,3,4-Benzenetetracarboxylic acid? |
| A: Related upstream materials(CAS) of 1,2,3,4-Benzenetetracarboxylic acid: 5325-97-3;85068-01-5;4488-40-8;605-70-9;571-58-4;5463-50-3;861292-77-5;857552-11-5;861566-94-1;1079-71-6. |
| Q: What are the downstream products of 1,2,3,4-Benzenetetracarboxylic acid? |
| A: Related downstream products(CAS) of 1,2,3,4-Benzenetetracarboxylic acid: 488-23-3;3451-02-3. |
| Q: What is the English name of 1,2,3,4-Benzenetetracarboxylic acid? |
| A: The English name of 1,2,3,4-Benzenetetracarboxylic acid is 1,2,3,4-Benzenetetracarboxylic acid. |
| Q: What is the molecular formula of 1,2,3,4-Benzenetetracarboxylic acid? |
| A: Molecular formula of 1,2,3,4-Benzenetetracarboxylic acid is C10H6O8. |
| Q: What English synonyms does 1,2,3,4-Benzenetetracarboxylic acid have? |
| A: English synonyms of 1,2,3,4-Benzenetetracarboxylic acid: 2-iodo-3,4-dibutyl-5-trimethylsilylethynylthiophene, Thiophene,3,4-dibutyl-2-iodo-5-[2-(trimethylsilyl)ethynyl], 1,2,3,4-benzenetetracaboxylic acid, benzene-1,2,3,4-tetracarboxylic acid, benzenetetracarboxylic acid, 3,4-dicarboxyphthalic acid, Benzol-1,2,3,4-tetracarbonsaeure, 3,4-dibutyl-2-iodo-5-trimethylsilylethynylthiophene. |
| Q: What is the CAS number of 1,2,3,4-Benzenetetracarboxylic acid? |
| A: CAS number of 1,2,3,4-Benzenetetracarboxylic acid is 476-73-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |