1,4-Naphthalenedicarboxylic acid structure
|
Common Name | 1,4-Naphthalenedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 605-70-9 | Molecular Weight | 216.189 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 490.2±28.0 °C at 760 mmHg | |
| Molecular Formula | C12H8O4 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 264.3±20.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,4-Naphthalenedicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 490.2±28.0 °C at 760 mmHg |
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.189 |
| Flash Point | 264.3±20.5 °C |
| Exact Mass | 216.042252 |
| PSA | 74.60000 |
| LogP | 3.23 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.708 |
| InChIKey | ABMFBCRYHDZLRD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)O)c2ccccc12 |
| Storage condition | 2~8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| HS Code | 2917399090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 210-094-7 |
| Naphthalene-1,4-dicarboxylic acid |
| 1,4-Naphthalenedicarboxylic acid |
| MFCD00014312 |