Ro4368554 structure
|
Common Name | Ro4368554 | ||
|---|---|---|---|---|
| CAS Number | 478082-99-4 | Molecular Weight | 355.45400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21N3O2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Ro4368554Ro4368554 is a 5-HT6 receptor antagonist. RO4368554 acts selectively at 5-HT6 receptors where it binds with a greater than 100-fold selectivity over other monoamine receptor subtypes (-log M pKi = 9.4 at 5-HT6 and 7.1 at 5-HT2A). |
| Name | 3-(benzenesulfonyl)-7-(4-methylpiperazin-1-yl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H21N3O2S |
|---|---|
| Molecular Weight | 355.45400 |
| Exact Mass | 355.13500 |
| PSA | 64.79000 |
| LogP | 3.83620 |
| InChIKey | AOPYPEADLGTXRA-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2cccc3c(S(=O)(=O)c4ccccc4)c[nH]c23)CC1 |
| 7-(4-methyl-1-piperazinyl)-3-(phenylsulfonyl)-1H-Indole |
| 3-benzenesulfonyl-7-(4-methyl-piperazin-1-yl)-1H-indole |
| 3-phenylsulfonyl-7-(4-methyl-piperazin-1-yl)-1H-indole |
| 1H-Indole,7-(4-methyl-1-piperazinyl)-3-(phenylsulfonyl) |