Uridine 5′-diphosphoglucose-13C disodium structure
|
Common Name | Uridine 5′-diphosphoglucose-13C disodium | ||
|---|---|---|---|---|
| CAS Number | 478529-38-3 | Molecular Weight | 611.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22N2Na2O17P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Uridine 5′-diphosphoglucose-13C disodiumUridine 5′-diphosphoglucose-13C disodium is the 13C labeled Uridine 5′-diphosphoglucose disodium salt. Uridine 5′-diphosphoglucose disodium salt (UDP-D-Glucose disodium salt) is the precursor of glucose-containing oligosaccharides, polysaccharides, glycop |
| Name | URIDINE DIPHOSPHATE-α-D-[1-13C]GLUCOSE DISODIUM SALT |
|---|
| Description | Uridine 5′-diphosphoglucose-13C disodium is the 13C labeled Uridine 5′-diphosphoglucose disodium salt. Uridine 5′-diphosphoglucose disodium salt (UDP-D-Glucose disodium salt) is the precursor of glucose-containing oligosaccharides, polysaccharides, glycop |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C15H22N2Na2O17P2 |
|---|---|
| Molecular Weight | 611.25800 |
| Exact Mass | 611.02200 |
| PSA | 322.27000 |
| InChIKey | PKJQEQVCYGYYMM-BGQDPYSYSA-L |
| SMILES | O=c1ccn(C2OC(COP(=O)([O-])OP(=O)([O-])OC3OC(CO)C(O)C(O)C3O)C(O)C2O)c(=O)[nH]1.[Na+].[Na+] |