Ethyl 5-chloro-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 5-chloro-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 4792-67-0 | Molecular Weight | 223.656 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 375.0±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H10ClNO2 | Melting Point | 166-168 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 180.6±22.3 °C | |
| Name | Ethyl 5-chloro-2-indolecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.0±22.0 °C at 760 mmHg |
| Melting Point | 166-168 °C(lit.) |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.656 |
| Flash Point | 180.6±22.3 °C |
| Exact Mass | 223.040009 |
| PSA | 42.09000 |
| LogP | 3.89 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | LWKIFKYHCJAIAB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Antiallergic agents. 3. N-(1H-tetrazol-5-yl)-2-pyridinecarboxamides.
J. Med. Chem. 27(2) , 125-28, (1984) A series of N-tetrazolylpyridinecarboxamides was prepared and evaluated for antiallergic activity by the passive cutaneous anaphylaxis (PCA) assay. From the structure-activity relationships (SAR) of t... |
| Ethyl 5-chloroindole-2-carboxylate |
| 5-Chloroindole-2-carboxylic acid ethyl |
| 5-Chloroindole-2-carboxylic Acid Ethyl Ester |
| 1H-Indole-2-carboxylic acid, 5-chloro-, ethyl ester |
| 5-chloro-2-Indolecarboxylic Acid Ethyl Ester |
| EINECS 225-345-6 |
| Ethyl 5-chloro-1H-indole-2-carboxylate |
| MFCD00005610 |