5,7-Dichloroindole-2-carboxylic acid ethyl ester structure
|
Common Name | 5,7-Dichloroindole-2-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 4792-70-5 | Molecular Weight | 258.10100 | |
| Density | 1.432g/cm3 | Boiling Point | 405ºC at 760 mmHg | |
| Molecular Formula | C11H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.7ºC | |
| Name | ethyl 5,7-dichloro-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 405ºC at 760 mmHg |
| Molecular Formula | C11H9Cl2NO2 |
| Molecular Weight | 258.10100 |
| Flash Point | 198.7ºC |
| Exact Mass | 257.00100 |
| PSA | 42.09000 |
| LogP | 3.65140 |
| Index of Refraction | 1.637 |
| InChIKey | CJYGKZGQACYLTI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc(Cl)cc(Cl)c2[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
5,7-Dichloroind... CAS#:4792-70-5 |
| Literature: PFIZER INC. Patent: EP1134213 A2, 2001 ; |
|
~%
5,7-Dichloroind... CAS#:4792-70-5 |
| Literature: Jablonowski, Jill A.; Grice, Cheryl A.; Chai, Wenying; Dvorak, Curt A.; Venable, Jennifer D.; Kwok, Annette K.; Ly, Kiev S.; Wei, Jianmei; Baker, Sherry M.; Desai, Pragnya J.; Jiang, Wen; Wilson, Sandy J.; Thurmond, Robin L.; Karlsson, Lars; Edwards, James P.; Lovenberg, Timothy W.; Carruthers, Nicholas I. Journal of Medicinal Chemistry, 2003 , vol. 46, # 19 p. 3957 - 3960 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,7-Dichlor-indol-2-carbonsaeure-ethylester |
| 5,7-dichloro-indole-2-carboxylic acid ethyl ester |
| 5,7-DICHLORO-1H-INDOLE-2-CARBOXYLIC ACID ETHYL ESTER |
| OR4199 |
| 5,7-Dichlor-indol-2-carbonsaeure-aethylester |
| Ethyl 5,7-dichloroindole-2-carboxylate |
| Ethyl-5,7-dichlorindol-2-carboxylat |