Isoniazid analog structure
|
Common Name | Isoniazid analog | ||
|---|---|---|---|---|
| CAS Number | 4813-07-4 | Molecular Weight | 270.24400 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-nitrophenyl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.24400 |
| Exact Mass | 270.07500 |
| PSA | 100.17000 |
| LogP | 2.66780 |
| Index of Refraction | 1.644 |
| InChIKey | HLPMEKJZGSAPBE-UHFFFAOYSA-N |
| SMILES | O=C(NN=Cc1ccc([N+](=O)[O-])cc1)c1ccncc1 |
| HS Code | 2933399090 |
|---|
|
~82%
Isoniazid analog CAS#:4813-07-4 |
| Literature: Shah; Mehta; Parikh Journal of the Indian Chemical Society, 1985 , vol. 62, # 3 p. 255 - 257 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Nitrobenzaldehyde isonicotinoyl hydrazone |
| 4-Nitrobenzaldehyd-isoniazid-hydrazon |
| isonicotinic acid-(4-nitro-benzylidenehydrazide) |
| Isonicotinsaeure-(4-nitro-benzylidenhydrazid) |
| N-Isonicotinoyl-N'-<4-nitro-benzyliden>-hydrazin |
| N'-(4-nitrobenzylidene)isonicotinohydrazide |
| <4-Nitro-benzaldehyd>-isonicotinoylhydrazon |
| N-((4-nitrophenyl)methylideneamino)pyridine-4-carboxamide |