1H-Isoindole-1,3(2H)-dione,2-(4-chloro-2-butyn-1-yl)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(4-chloro-2-butyn-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 4819-69-6 | Molecular Weight | 233.65000 | |
| Density | 1.391g/cm3 | Boiling Point | 389.3ºC at 760mmHg | |
| Molecular Formula | C12H8ClNO2 | Melting Point | 115-116ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-Chloro-2-butynyl)phthalimide, |
|---|---|
| Synonym | More Synonyms |
| Density | 1.391g/cm3 |
|---|---|
| Boiling Point | 389.3ºC at 760mmHg |
| Melting Point | 115-116ºC |
| Molecular Formula | C12H8ClNO2 |
| Molecular Weight | 233.65000 |
| Exact Mass | 233.02400 |
| PSA | 37.38000 |
| LogP | 1.46270 |
| Index of Refraction | 1.621 |
| InChIKey | TXNDRPKNOXQAAO-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CC#CCCl |
|
~71%
1H-Isoindole-1,... CAS#:4819-69-6 |
| Literature: Jeon, Heung-Bae; Lee, Younghee; Qiao, Chunhua; Huang, He; Sayre, Lawrence M. Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 21 p. 4631 - 4641 |
|
~%
1H-Isoindole-1,... CAS#:4819-69-6 |
| Literature: TAKEDA PHARMACEUTICAL COMPANY LIMITED; MATSUMOTO, Shigemitsu; ONO, Koji; TOMINARI, Yusuke; KATOH, Taisuke; MIWA, Kazuhiro; HASUOKA, Atsushi; IMAMURA, Shinichi Patent: WO2013/18929 A1, 2013 ; Location in patent: Paragraph 0456 ; WO 2013/018929 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-(4-chloro-2-butynyl)phthalimide |
| 1-Chloro-4-(N-phthalimido)-2-butyne |
| N-(4-chloro-but-2-ynyl)-phthalimide |
| MFCD01318120 |
| 2-(4-chlorobut-2-ynyl)isoindoline-1,3-dione |
| N-(4-Chlor-but-2-inyl)-phthalimid |
| 2-(4-chlorobut-2-yn-1-yl)-1H-isoindole-1,3(2H)-dione |
| 1-chloro-4-phthalimido-2-butyne |