Yohimban-16-carboxylicacid, 17-hydroxy-, methyl ester, (16b,17a)- structure
|
Common Name | Yohimban-16-carboxylicacid, 17-hydroxy-, methyl ester, (16b,17a)- | ||
|---|---|---|---|---|
| CAS Number | 483-10-3 | Molecular Weight | 354.44 | |
| Density | 1.31g/cm3 | Boiling Point | 543ºC at 760mmHg | |
| Molecular Formula | C21H26N2O3 | Melting Point | 225-230ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of Yohimban-16-carboxylicacid, 17-hydroxy-, methyl ester, (16b,17a)-Corynanthine is a selective α1-adrenergic receptor antagonist. Corynanthine can significantly lower intraocular pressure in rabbits[1]. |
| Name | Corynanthine |
|---|---|
| Synonym | More Synonyms |
| Description | Corynanthine is a selective α1-adrenergic receptor antagonist. Corynanthine can significantly lower intraocular pressure in rabbits[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 543ºC at 760mmHg |
| Melting Point | 225-230ºC |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.44 |
| Exact Mass | 354.19400 |
| PSA | 65.56000 |
| LogP | 2.58500 |
| Vapour Pressure | 1.27E-12mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | BLGXFZZNTVWLAY-DKJBZYCGSA-N |
| SMILES | COC(=O)C1C(O)CCC2CN3CCc4c([nH]c5ccccc45)C3CC21 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| RAUHIMBINE |
| Rauhimbin |
| Corynanthin |
| corynanthine free base |
| corynantine |
| rauwolscine |
| Coynanthine |
| CORYNANTHINE DIHYDRATE |