2-Methoxy-5-(trifluoromethyl)benzoic acid structure
|
Common Name | 2-Methoxy-5-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4864-01-1 | Molecular Weight | 220.14500 | |
| Density | 1.38 | Boiling Point | 285ºC | |
| Molecular Formula | C9H7F3O3 | Melting Point | 108-111ºC | |
| MSDS | N/A | Flash Point | 126ºC | |
| Name | 2-Methoxy-5-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38 |
|---|---|
| Boiling Point | 285ºC |
| Melting Point | 108-111ºC |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.14500 |
| Flash Point | 126ºC |
| Exact Mass | 220.03500 |
| PSA | 46.53000 |
| LogP | 2.41220 |
| Index of Refraction | 1.474 |
| InChIKey | NAKZCKOHULJEID-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(F)(F)F)cc1C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~%
2-Methoxy-5-(tr... CAS#:4864-01-1 |
| Literature: WO2011/25982 A2, ; Page/Page column 145 ; |
|
~%
2-Methoxy-5-(tr... CAS#:4864-01-1
Detail
|
| Literature: US2007/88070 A1, ; Page/Page column 17 ; US 20070088070 A1 |
|
~%
2-Methoxy-5-(tr... CAS#:4864-01-1 |
| Literature: US3953595 A1, ; |
|
~%
2-Methoxy-5-(tr... CAS#:4864-01-1 |
| Literature: WO2011/25982 A2, ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-METHOXY-5-TRIFLUOROMETHYLBENZOIC ACID |
| 2-Methoxy-5-trifluormethylbenzoesaeure |