3-methoxy-5-(trifluoromethyl)benzoic acid structure
|
Common Name | 3-methoxy-5-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 53985-48-1 | Molecular Weight | 220.14500 | |
| Density | 1.38g/cm3 | Boiling Point | 290.7ºC at 760 mmHg | |
| Molecular Formula | C9H7F3O3 | Melting Point | 141-143 °C | |
| MSDS | N/A | Flash Point | 129.6ºC | |
| Name | 3-methoxy-5-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 290.7ºC at 760 mmHg |
| Melting Point | 141-143 °C |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.14500 |
| Flash Point | 129.6ºC |
| Exact Mass | 220.03500 |
| PSA | 46.53000 |
| LogP | 2.41220 |
| Index of Refraction | 1.474 |
| InChIKey | VAQSHRZOMRFBCX-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~%
3-methoxy-5-(tr... CAS#:53985-48-1 |
| Literature: US3953595 A1, ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Carboxy-5-(trifluoromethyl)anisole |
| PC3659 |
| 3-Methoxy-5-trifluormethyl-benzoesaeure |
| CL9003 |
| 3-methoxy-5-trifluoromethyl-benzoic acid |
| 3-Carboxy-5-methoxybenzotrifluoride |