4-[(2-hydroxyphenyl)azo]resorcinol structure
|
Common Name | 4-[(2-hydroxyphenyl)azo]resorcinol | ||
|---|---|---|---|---|
| CAS Number | 4867-02-1 | Molecular Weight | 230.21900 | |
| Density | 1.35g/cm3 | Boiling Point | 464ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.8ºC | |
| Name | (4E)-3-hydroxy-4-[(2-hydroxyphenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 464ºC at 760 mmHg |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.21900 |
| Flash Point | 305.8ºC |
| Exact Mass | 230.06900 |
| PSA | 81.92000 |
| LogP | 1.81390 |
| Index of Refraction | 1.641 |
| InChIKey | UYZDJWAAXREYDP-UHFFFAOYSA-N |
| SMILES | Oc1ccc(N=Nc2ccccc2O)c(O)c1 |
|
~%
4-[(2-hydroxyph... CAS#:4867-02-1 |
| Literature: Tedder; Theaker Journal of the Chemical Society, 1959 , p. 257,262 |
|
~%
4-[(2-hydroxyph... CAS#:4867-02-1 |
| Literature: CIBA Patent: US1895559 , 1928 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,2',4'-trihydroxyazobenzene |
| EINECS 225-474-8 |
| o,o',p-trihydroxyazobenzene |