bufotenidine
bufotenidine structure
|
Common Name | bufotenidine | ||
|---|---|---|---|---|
| CAS Number | 487-91-2 | Molecular Weight | 218.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18N2O |
|---|---|
| Molecular Weight | 218.29500 |
| Exact Mass | 218.14200 |
| PSA | 38.85000 |
| LogP | 2.56040 |
| InChIKey | HIYGARYIJIZXGW-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCc1c[nH]c2ccc([O-])cc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bufotenidine CAS#:487-91-2 |
| Literature: Wieland et al. Justus Liebigs Annalen der Chemie, 1934 , vol. 513, p. 1,18 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| bufotenidine |
| 5-HTQ |
| 1H-Indole-3-ethanaminium,5-hydroxy-N,N,N-trimethyl-,hydroxide,inner salt |
| Bufotenidin |
| 5-Hydroxy-N,N,N-trimethyltryptammonium |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate? |
| A: The English name of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate is 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate. |
| Q: What are the upstream materials of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate? |
| A: Related upstream materials(CAS) of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate: 186581-53-3;487-93-4. |
| Q: What is the InChIKey of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate? |
| A: InChIKey of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate is HIYGARYIJIZXGW-UHFFFAOYSA-N. |
| Q: What English synonyms does 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate have? |
| A: English synonyms of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate: bufotenidine, 5-HTQ, 1H-Indole-3-ethanaminium,5-hydroxy-N,N,N-trimethyl-,hydroxide,inner salt, Bufotenidin, 5-Hydroxy-N,N,N-trimethyltryptammonium. |
| Q: What is the molecular weight of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate? |
| A: Molecular weight of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate is 218.29500. |
| Q: What is the CAS number of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate? |
| A: CAS number of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate is 487-91-2. |
| Q: What is the molecular formula of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate? |
| A: Molecular formula of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate is C13H18N2O. |
| Q: What is the polar surface area (PSA) of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate? |
| A: Polar surface area (PSA) of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate is 38.85000. |
| Q: What is the SMILES notation of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate? |
| A: SMILES notation of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate is C[N+](C)(C)CCc1c[nH]c2ccc([O-])cc12. |
| Q: What is the LogP of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate? |
| A: LogP of 3-[2-(trimethylazaniumyl)ethyl]-1H-indol-5-olate is 2.56040. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| naturewill |