2-(4-methylanilino)isoindole-1,3-dione structure
|
Common Name | 2-(4-methylanilino)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 4870-23-9 | Molecular Weight | 252.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methylanilino)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12N2O2 |
|---|---|
| Molecular Weight | 252.26800 |
| Exact Mass | 252.09000 |
| PSA | 49.41000 |
| LogP | 2.62900 |
| InChIKey | BMVWNSVTDHRZKT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NN2C(=O)c3ccccc3C2=O)cc1 |
|
~%
2-(4-methylanil... CAS#:4870-23-9 |
| Literature: Chattaway; Wuensch Journal of the Chemical Society, 1911 , vol. 99, p. 2259 |
| 2-p-toluidino-isoindoline-1,3-dione |
| 2-p-Toluidino-isoindolin-1,3-dion |
| 12L-018 |