2-Phenyl-isoindole-1,3-dione structure
|
Common Name | 2-Phenyl-isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 520-03-6 | Molecular Weight | 223.227 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 388.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H9NO2 | Melting Point | 204-207 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 182.6±15.5 °C | |
| Name | N-Phenylphthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 388.8±25.0 °C at 760 mmHg |
| Melting Point | 204-207 °C(lit.) |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.227 |
| Flash Point | 182.6±15.5 °C |
| Exact Mass | 223.063324 |
| PSA | 37.38000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | MFUPLJQNEXUUDW-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Safety Phrases | S22-S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | TI5635800 |
| HS Code | 2925190090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Identification of the binding modes of N-phenylphthalimides inhibiting bacterial thymidylate synthase through X-ray crystallography screening.
J. Med. Chem. 54 , 5454, (2011) To identify specific bacterial thymidylate synthase (TS) inhibitors, we exploited phenolphthalein (PTH), which inhibits both bacterial and human enzymes. The X-ray crystal structure of Lactobacillus c... |
|
|
Phenylphthalimides with tumor necrosis factor alpha production-enhancing activity.
Chem. Pharm. Bull. 44(1) , 156-62, (1996) Phenylphthalimides (2-phenyl-1H-isoindole-1,3-diones) were prepared and their effects on tumor necrosis factor alpha (TNF-alpha) production by human leukemia cell line HL-60 stimulated with 12-O-tetra... |
|
|
Nonpeptide small-molecular inhibitors of dipeptidyl peptidase IV: N-phenylphthalimide analogs.
Bioorg. Med. Chem. Lett. 9(4) , 559-62, (1999) A novel series of nonpeptide small-molecular dipeptidyl peptidase IV (DPP-IV) inhibitors with an N-phenylphthalimide skeleton has been developed. Some of the compounds, including 4-amino-(2,6-dimethyl... |
| EINECS 208-282-9 |
| 2-Phenyl-1H-isoindole-1,3(2H)-dione |
| 1H-Isoindole-1,3(2H)-dione, 2-phenyl- |
| 2-Phenylisoindole-1,3-dione |
| 2-Phenyl-isoindole-1,3-dione |
| MFCD00023044 |
| N-PHENYLPHTHALIMIDE |