2-(4-Bromobutoxy)Isoindoline-1,3-Dione structure
|
Common Name | 2-(4-Bromobutoxy)Isoindoline-1,3-Dione | ||
|---|---|---|---|---|
| CAS Number | 5093-32-3 | Molecular Weight | 298.13300 | |
| Density | 1.57g/cm3 | Boiling Point | 403.6ºC at 760 mmHg | |
| Molecular Formula | C12H12BrNO3 | Melting Point | 70-72ºC | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | 2-(4-bromobutoxy)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 403.6ºC at 760 mmHg |
| Melting Point | 70-72ºC |
| Molecular Formula | C12H12BrNO3 |
| Molecular Weight | 298.13300 |
| Flash Point | 197.9ºC |
| Exact Mass | 297.00000 |
| PSA | 46.61000 |
| LogP | 2.32720 |
| Index of Refraction | 1.613 |
| InChIKey | HNQARTGCJCNOSX-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1OCCCCBr |
| Storage condition | 2-8°C |
|
~92%
2-(4-Bromobutox... CAS#:5093-32-3 |
| Literature: Fakhari, Fazel; Chen, Yun-Yun K.; Rokita, Steven E. Chemical Communications, 2013 , vol. 49, # 63 p. 7073 - 7075 |
|
~%
2-(4-Bromobutox... CAS#:5093-32-3 |
| Literature: Rathore, Kavita; Vyas, Ritu; Talesara Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2005 , vol. 44, # 10 p. 2166 - 2170 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00517028 |
| 2-(4-BROMOBUTOXY)-1H-ISOINDOLE-1,3(2H)-DIONE |
| N-(4-BROMOBUTOXY)PHTHALIMIDE |
| N-(4-bromobutyloxy)phthalimide |