Globulol structure
|
Common Name | Globulol | ||
|---|---|---|---|---|
| CAS Number | 489-41-8 | Molecular Weight | 222.36600 | |
| Density | 0.962g/cm3 | Boiling Point | 283ºC | |
| Molecular Formula | C15H26O | Melting Point | 87-88ºC | |
| MSDS | Chinese USA | Flash Point | 123.1ºC | |
| Name | (-)-globulol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.962g/cm3 |
|---|---|
| Boiling Point | 283ºC |
| Melting Point | 87-88ºC |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.36600 |
| Flash Point | 123.1ºC |
| Exact Mass | 222.19800 |
| PSA | 20.23000 |
| LogP | 3.46570 |
| Vapour Pressure | 0.000177mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | AYXPYQRXGNDJFU-QTPLKFIXSA-N |
| SMILES | CC1CCC2C1C1C(CCC2(C)O)C1(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| 10-Aromadendranol |